Search results
This program determines the molecular mass of a substance. Enter the molecular formula of the substance. It will calculate the total mass along with the elemental composition and mass of each element in the compound. Use uppercase for the first character in the element and lowercase for the second character.
- Computing Molar Mass
- Definitions
- Steps to Calculate Molar Mass
- Example: Calculating Molar Mass
Any chemical element. Capitalize the first letter in chemical symbol and use lower case for the remaining letters: Ca, Fe, Mg, Mn, S, O, H, C, N, Na, K, Cl, Al.Functional groups: D, Ph, Me, Et, Bu, AcAc, For, Tos, Bz, TMS, tBu, Bzl, Bn, Dmgparenthesis () or brackets .Common compound names.Molecular mass (molecular weight) is the mass of one molecule of a substance and is expressed in the unified atomic mass units (u). (1 u is equal to 1/12 the mass of one atom of carbon-12)Molar mass (molar weight) is the mass of one mole of a substance and is expressed in g/mol.Mole is a standard scientific unit for measuring large quantities of very small entities such as atoms and molecules. One mole contains exactly 6.022 ×1023particles (Avogadro's number)Identify the compound: write down the chemical formula of the compound. For example, water is H2O, meaning it contains two hydrogen atoms and one oxygen atom.Find atomic masses:look up the atomic masses of each element present in the compound. The atomic mass is usually found on the periodic table and is given in atomic mass units (amu).Calculate molar mass of each element:multiply the atomic mass of each element by the number of atoms of that element in the compound.Add them together:add the results from step 3 to get the total molar mass of the compound.Let's calculate the molar mass of carbon dioxide (CO2): 1. Carbon (C) has an atomic mass of about 12.01 amu. 2. Oxygen (O) has an atomic mass of about 16.00 amu. 3. CO2has one carbon atom and two oxygen atoms. 4. The molar mass of carbon dioxide is 12.01 + (2 × 16.00) = 44.01 g/mol.
Calculate the molar mass of Sodium Bicarbonate in grams per mole or search for a chemical formula or substance.
Molecular weight: 84.0066 IUPAC Standard InChI: InChI=1S/CH2O3.Na/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1 Copy IUPAC Standard InChIKey: UIIMBOGNXHQVGW-UHFFFAOYSA-M Copy
Apr 22, 2024 · Sodium bicarbonate, formula NaHCO 3, is a white crystalline solid soluble in water. It is also known by other synonyms: sodium hydrogen carbonate or bicarbonate of soda. It has a slightly alkaline taste similar to sodium carbonate, although less strong and more salty.
Jan 27, 2017 · Gets facts about sodium bicarbonate or baking soda, including its chemical formula, alternate names, molecular weight, melting point, and density.
People also ask
What is sodium bicarbonate?
How to find molar mass of sodium bicarbonate?
What is the molecular weight of sodium bicarbonate water?
Is sodium bicarbonate a strong base?
Sodium bicarbonate, also known as baking soda, is a widely used chemical compound with the formula NaHCO 3. This white solid crystalline substance has diverse applications, spanning across various industries such as food, health, cleaning, and more.
